C21H21FN2O2 — CID 1278761
N'-[(1S,6R)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carbonyl]benzohydrazide (PubChem CID 1278761) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is N'-[(1S,6R)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carbonyl]benzohydrazide.
| Compound Name | N'-[(1S,6R)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carbonyl]benzohydrazide |
|---|---|
| PubChem CID | 1278761 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N'-[(1S,6R)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carbonyl]benzohydrazide |
| SMILES | CC1=CC[C@H](C(=O)NNC(=O)c2ccccc2)[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H21FN2O2/c1-14-7-12-18(19(13-14)15-8-10-17(22)11-9-15)21(26)24-23-20(25)16-5-3-2-4-6-16/h2-11,18-19H,12-13H2,1H3,(H,23,25)(H,24,26)/t18-,19-/m0/s1 |
| InChIKey | GXQOWXCASQDOGZ-OALUTQOASA-N |
| XLogP | 3.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|