C19H15FN2O3 — CID 31725615
N'-[2-(4-fluorophenyl)acetyl]-3-hydroxynaphthalene-2-carbohydrazide (PubChem CID 31725615) has the molecular formula C19H15FN2O3 and a molecular weight of 338.34 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)acetyl]-3-hydroxynaphthalene-2-carbohydrazide.
| Compound Name | N'-[2-(4-fluorophenyl)acetyl]-3-hydroxynaphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 31725615 |
| Molecular Formula | C19H15FN2O3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N'-[2-(4-fluorophenyl)acetyl]-3-hydroxynaphthalene-2-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C19H15FN2O3/c20-15-7-5-12(6-8-15)9-18(24)21-22-19(25)16-10-13-3-1-2-4-14(13)11-17(16)23/h1-8,10-11,23H,9H2,(H,21,24)(H,22,25) |
| InChIKey | MWSIBWTUSCTJJQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|