C22H15FN2O4 — CID 18272087
5-(4-fluorophenyl)-N'-(3-hydroxynaphthalene-2-carbonyl)furan-2-carbohydrazide (PubChem CID 18272087) has the molecular formula C22H15FN2O4 and a molecular weight of 390.37 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N'-(3-hydroxynaphthalene-2-carbonyl)furan-2-carbohydrazide.
| Compound Name | 5-(4-fluorophenyl)-N'-(3-hydroxynaphthalene-2-carbonyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 18272087 |
| Molecular Formula | C22H15FN2O4 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 5-(4-fluorophenyl)-N'-(3-hydroxynaphthalene-2-carbonyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc2ccccc2cc1O)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C22H15FN2O4/c23-16-7-5-13(6-8-16)19-9-10-20(29-19)22(28)25-24-21(27)17-11-14-3-1-2-4-15(14)12-18(17)26/h1-12,26H,(H,24,27)(H,25,28) |
| InChIKey | KAKJAWHFQQAFHC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|