C18H12ClFN2O3 — CID 24900153
N'-(2-chlorobenzoyl)-5-(3-fluorophenyl)furan-2-carbohydrazide (PubChem CID 24900153) has the molecular formula C18H12ClFN2O3 and a molecular weight of 358.76 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-5-(3-fluorophenyl)furan-2-carbohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-5-(3-fluorophenyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 24900153 |
| Molecular Formula | C18H12ClFN2O3 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N'-(2-chlorobenzoyl)-5-(3-fluorophenyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1Cl)c1ccc(-c2cccc(F)c2)o1 |
| InChI | InChI=1S/C18H12ClFN2O3/c19-14-7-2-1-6-13(14)17(23)21-22-18(24)16-9-8-15(25-16)11-4-3-5-12(20)10-11/h1-10H,(H,21,23)(H,22,24) |
| InChIKey | YWMTWGNIIANYDJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|