C18H12F2N2O3 — CID 9084734
N'-(2-fluorobenzoyl)-5-(4-fluorophenyl)furan-2-carbohydrazide (PubChem CID 9084734) has the molecular formula C18H12F2N2O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is N'-(2-fluorobenzoyl)-5-(4-fluorophenyl)furan-2-carbohydrazide.
| Compound Name | N'-(2-fluorobenzoyl)-5-(4-fluorophenyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9084734 |
| Molecular Formula | C18H12F2N2O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N'-(2-fluorobenzoyl)-5-(4-fluorophenyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1F)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H12F2N2O3/c19-12-7-5-11(6-8-12)15-9-10-16(25-15)18(24)22-21-17(23)13-3-1-2-4-14(13)20/h1-10H,(H,21,23)(H,22,24) |
| InChIKey | PDMKYGFLILHQBM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|