(2S)-1,3-oxazinane-2-carboxylic acid

C5H9NO3 — CID 142515360

IUPAC(2S)-1,3-oxazinane-2-carboxylic acid
SMILESO=C(O)[C@H]1NCCCO1
InChIInChI=1S/C5H9NO3/c7-5(8)4-6-2-1-3-9-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1
InChIKeyLIPZBIGWJNGUAJ-BYPYZUCNSA-N
MW131.13 g/mol
LogP-0.59
Rot. Bonds1

About (2S)-1,3-oxazinane-2-carboxylic acid

(2S)-1,3-oxazinane-2-carboxylic acid (PubChem CID 142515360) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is (2S)-1,3-oxazinane-2-carboxylic acid.

Molecular Properties

Compound Name(2S)-1,3-oxazinane-2-carboxylic acid
PubChem CID142515360
Molecular FormulaC5H9NO3
Molecular Weight131.13 g/mol
Exact Mass131.06
IUPAC Name(2S)-1,3-oxazinane-2-carboxylic acid
SMILESO=C(O)[C@H]1NCCCO1
InChIInChI=1S/C5H9NO3/c7-5(8)4-6-2-1-3-9-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1
InChIKeyLIPZBIGWJNGUAJ-BYPYZUCNSA-N
XLogP-0.59
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.13
LogP ≤ 5-0.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S)-1,3-oxazinane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-1,3-oxazinane-2-carboxylic acid?
The IUPAC name of (2S)-1,3-oxazinane-2-carboxylic acid (CID 142515360) is (2S)-1,3-oxazinane-2-carboxylic acid.
What is the SMILES notation for (2S)-1,3-oxazinane-2-carboxylic acid?
The canonical SMILES for (2S)-1,3-oxazinane-2-carboxylic acid is O=C(O)[C@H]1NCCCO1.
What is the InChIKey of (2S)-1,3-oxazinane-2-carboxylic acid?
The InChIKey is LIPZBIGWJNGUAJ-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H9NO3/c7-5(8)4-6-2-1-3-9-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1.
What are the key properties of (2S)-1,3-oxazinane-2-carboxylic acid?
(2S)-1,3-oxazinane-2-carboxylic acid has a molecular weight of 131.13 g/mol, XLogP of -0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,3-oxazinane-2-carboxylic acid is sourced from PubChem (CID 142515360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).