C5H9NO3 — CID 142515360
(2S)-1,3-oxazinane-2-carboxylic acid (PubChem CID 142515360) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is (2S)-1,3-oxazinane-2-carboxylic acid.
| Compound Name | (2S)-1,3-oxazinane-2-carboxylic acid |
|---|---|
| PubChem CID | 142515360 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | (2S)-1,3-oxazinane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1NCCCO1 |
| InChI | InChI=1S/C5H9NO3/c7-5(8)4-6-2-1-3-9-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1 |
| InChIKey | LIPZBIGWJNGUAJ-BYPYZUCNSA-N |
| XLogP | -0.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |