C5H8ClNO2 — CID 23220108
2-chloro-1-(1,3-oxazolidin-2-yl)ethanone (PubChem CID 23220108) has the molecular formula C5H8ClNO2 and a molecular weight of 149.58 g/mol. Its IUPAC name is 2-chloro-1-(1,3-oxazolidin-2-yl)ethanone.
| Compound Name | 2-chloro-1-(1,3-oxazolidin-2-yl)ethanone |
|---|---|
| PubChem CID | 23220108 |
| Molecular Formula | C5H8ClNO2 |
| Molecular Weight | 149.58 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | 2-chloro-1-(1,3-oxazolidin-2-yl)ethanone |
| SMILES | O=C(CCl)C1NCCO1 |
| InChI | InChI=1S/C5H8ClNO2/c6-3-4(8)5-7-1-2-9-5/h5,7H,1-3H2 |
| InChIKey | UCSVCTBGUQIAOI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.58 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|