C8H14ClNO3 — CID 130658722
3-chloro-N-(1,4-dioxepan-6-yl)propanamide (PubChem CID 130658722) has the molecular formula C8H14ClNO3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-chloro-N-(1,4-dioxepan-6-yl)propanamide.
| Compound Name | 3-chloro-N-(1,4-dioxepan-6-yl)propanamide |
|---|---|
| PubChem CID | 130658722 |
| Molecular Formula | C8H14ClNO3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-chloro-N-(1,4-dioxepan-6-yl)propanamide |
| SMILES | O=C(CCCl)NC1COCCOC1 |
| InChI | InChI=1S/C8H14ClNO3/c9-2-1-8(11)10-7-5-12-3-4-13-6-7/h7H,1-6H2,(H,10,11) |
| InChIKey | SMJPHNPRLQTZTE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|