C8H15NO3S — CID 130616046
N-(1,4-dioxepan-6-yl)-3-sulfanylpropanamide (PubChem CID 130616046) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is N-(1,4-dioxepan-6-yl)-3-sulfanylpropanamide.
| Compound Name | N-(1,4-dioxepan-6-yl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 130616046 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | N-(1,4-dioxepan-6-yl)-3-sulfanylpropanamide |
| SMILES | O=C(CCS)NC1COCCOC1 |
| InChI | InChI=1S/C8H15NO3S/c10-8(1-4-13)9-7-5-11-2-3-12-6-7/h7,13H,1-6H2,(H,9,10) |
| InChIKey | AESQZPLUGWIAFB-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|