About 2-(2-methylprop-2-enyl)oxirane;urea
2-(2-methylprop-2-enyl)oxirane;urea (PubChem CID 159105075) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)oxirane;urea.
Molecular Properties
| Compound Name | 2-(2-methylprop-2-enyl)oxirane;urea |
| PubChem CID | 159105075 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-(2-methylprop-2-enyl)oxirane;urea |
| SMILES | C=C(C)CC1CO1.NC(N)=O |
| InChI | InChI=1S/C6H10O.CH4N2O/c1-5(2)3-6-4-7-6;2-1(3)4/h6H,1,3-4H2,2H3;(H4,2,3,4) |
| InChIKey | KDTWPDJRCFYRBI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-2-enyl)oxirane;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-2-enyl)oxirane;urea?
The IUPAC name of 2-(2-methylprop-2-enyl)oxirane;urea (CID 159105075) is 2-(2-methylprop-2-enyl)oxirane;urea.
What is the SMILES notation for 2-(2-methylprop-2-enyl)oxirane;urea?
The canonical SMILES for 2-(2-methylprop-2-enyl)oxirane;urea is C=C(C)CC1CO1.NC(N)=O.
What is the InChIKey of 2-(2-methylprop-2-enyl)oxirane;urea?
The InChIKey is KDTWPDJRCFYRBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.CH4N2O/c1-5(2)3-6-4-7-6;2-1(3)4/h6H,1,3-4H2,2H3;(H4,2,3,4).
What are the key properties of 2-(2-methylprop-2-enyl)oxirane;urea?
2-(2-methylprop-2-enyl)oxirane;urea has a molecular weight of 158.20 g/mol, XLogP of 0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-2-enyl)oxirane;urea is sourced from PubChem (CID 159105075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).