About 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane
3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174467086) has the molecular formula C15H20O5
and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 174467086 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.C=Cc1c(C)ccc(O)c1O |
| InChI | InChI=1S/C9H10O2.C6H10O3/c1-3-7-6(2)4-5-8(10)9(7)11;1(5-3-8-5)7-2-6-4-9-6/h3-5,10-11H,1H2,2H3;5-6H,1-4H2 |
| InChIKey | KGCGLBRCFDQZOV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 174467086) is 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.C=Cc1c(C)ccc(O)c1O.
What is the InChIKey of 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is KGCGLBRCFDQZOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C6H10O3/c1-3-7-6(2)4-5-8(10)9(7)11;1(5-3-8-5)7-2-6-4-9-6/h3-5,10-11H,1H2,2H3;5-6H,1-4H2.
What are the key properties of 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 280.32 g/mol, XLogP of 1.85, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-4-methylbenzene-1,2-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 174467086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).