About 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene
2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene (PubChem CID 87233413) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene |
| PubChem CID | 87233413 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene |
| SMILES | C(OCC1CO1)C1CO1.C=CCc1ccccc1 |
| InChI | InChI=1S/C9H10.C6H10O3/c1-2-6-9-7-4-3-5-8-9;1(5-3-8-5)7-2-6-4-9-6/h2-5,7-8H,1,6H2;5-6H,1-4H2 |
| InChIKey | HQCASAUZICOTRP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene (CID 87233413) is 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene is C(OCC1CO1)C1CO1.C=CCc1ccccc1.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene?
The InChIKey is HQCASAUZICOTRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C6H10O3/c1-2-6-9-7-4-3-5-8-9;1(5-3-8-5)7-2-6-4-9-6/h2-5,7-8H,1,6H2;5-6H,1-4H2.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene?
2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene has a molecular weight of 248.32 g/mol, XLogP of 2.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;prop-2-enylbenzene is sourced from PubChem (CID 87233413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).