C9H13N3O6 — CID 174688773
2-(oxiran-2-ylmethoxymethyl)oxirane;1,3,5-triazinane-2,4,6-trione (PubChem CID 174688773) has the molecular formula C9H13N3O6 and a molecular weight of 259.22 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;1,3,5-triazinane-2,4,6-trione.
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 174688773 |
| Molecular Formula | C9H13N3O6 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;1,3,5-triazinane-2,4,6-trione |
| SMILES | C(OCC1CO1)C1CO1.O=c1[nH]c(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H10O3.C3H3N3O3/c1(5-3-8-5)7-2-6-4-9-6;7-1-4-2(8)6-3(9)5-1/h5-6H,1-4H2;(H3,4,5,6,7,8,9) |
| InChIKey | YWYUIJLISILHQO-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|