C18H30O6S — CID 175622490
2-[[(E)-4-methylsulfanyl-2,2-bis[2-(oxiran-2-ylmethoxy)ethyl]but-3-enoxy]methyl]oxirane (PubChem CID 175622490) has the molecular formula C18H30O6S and a molecular weight of 374.50 g/mol. Its IUPAC name is 2-[[(E)-4-methylsulfanyl-2,2-bis[2-(oxiran-2-ylmethoxy)ethyl]but-3-enoxy]methyl]oxirane.
| Compound Name | 2-[[(E)-4-methylsulfanyl-2,2-bis[2-(oxiran-2-ylmethoxy)ethyl]but-3-enoxy]methyl]oxirane |
|---|---|
| PubChem CID | 175622490 |
| Molecular Formula | C18H30O6S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-[[(E)-4-methylsulfanyl-2,2-bis[2-(oxiran-2-ylmethoxy)ethyl]but-3-enoxy]methyl]oxirane |
| SMILES | CS/C=C/C(CCOCC1CO1)(CCOCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C18H30O6S/c1-25-7-4-18(14-21-10-17-13-24-17,2-5-19-8-15-11-22-15)3-6-20-9-16-12-23-16/h4,7,15-17H,2-3,5-6,8-14H2,1H3/b7-4+ |
| InChIKey | WQJNWFWHXWGFGN-QPJJXVBHSA-N |
| XLogP | 1.88 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|