C13H22F4O6 — CID 174192252
2-[2-[[2-(1,1-difluoro-2-propoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxymethyl]oxirane (PubChem CID 174192252) has the molecular formula C13H22F4O6 and a molecular weight of 350.31 g/mol. Its IUPAC name is 2-[2-[[2-(1,1-difluoro-2-propoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxymethyl]oxirane.
| Compound Name | 2-[2-[[2-(1,1-difluoro-2-propoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 174192252 |
| Molecular Formula | C13H22F4O6 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[2-[[2-(1,1-difluoro-2-propoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxymethyl]oxirane |
| SMILES | CCCOCC(F)(F)OC(F)(F)COCOCCOCC1CO1 |
| InChI | InChI=1S/C13H22F4O6/c1-2-3-19-8-12(14,15)23-13(16,17)9-21-10-20-5-4-18-6-11-7-22-11/h11H,2-10H2,1H3 |
| InChIKey | QUKXLKLIJOZHDP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|