C16H26O8 — CID 167194592
4-[2-[5-[(2-oxo-1,3-dioxolan-4-yl)methoxy]hexoxy]propyl]-1,3-dioxolan-2-one (PubChem CID 167194592) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-[2-[5-[(2-oxo-1,3-dioxolan-4-yl)methoxy]hexoxy]propyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[2-[5-[(2-oxo-1,3-dioxolan-4-yl)methoxy]hexoxy]propyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 167194592 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[2-[5-[(2-oxo-1,3-dioxolan-4-yl)methoxy]hexoxy]propyl]-1,3-dioxolan-2-one |
| SMILES | CC(CCCCOC(C)CC1COC(=O)O1)OCC1COC(=O)O1 |
| InChI | InChI=1S/C16H26O8/c1-11(20-9-14-10-22-16(18)24-14)5-3-4-6-19-12(2)7-13-8-21-15(17)23-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | SUEDCGLNQFAPHM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|