C18H31MoO7- — CID 176917612
ethyl (4R,5S)-5-[(2S)-3-ethoxy-2-hydroxy-3-oxopropyl]-2-heptyl-1,3-dioxolane-4-carboxylate;molybdenum (PubChem CID 176917612) has the molecular formula C18H31MoO7- and a molecular weight of 455.38 g/mol. Its IUPAC name is ethyl (4R,5S)-5-[(2S)-3-ethoxy-2-hydroxy-3-oxopropyl]-2-heptyl-1,3-dioxolane-4-carboxylate;molybdenum.
| Compound Name | ethyl (4R,5S)-5-[(2S)-3-ethoxy-2-hydroxy-3-oxopropyl]-2-heptyl-1,3-dioxolane-4-carboxylate;molybdenum |
|---|---|
| PubChem CID | 176917612 |
| Molecular Formula | C18H31MoO7- |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | ethyl (4R,5S)-5-[(2S)-3-ethoxy-2-hydroxy-3-oxopropyl]-2-heptyl-1,3-dioxolane-4-carboxylate;molybdenum |
| SMILES | CCCCCCCC1O[C@@H]([CH-][C@H](O)C(=O)OCC)[C@H](C(=O)OCC)O1.[Mo] |
| InChI | InChI=1S/C18H31O7.Mo/c1-4-7-8-9-10-11-15-24-14(12-13(19)17(20)22-5-2)16(25-15)18(21)23-6-3;/h12-16,19H,4-11H2,1-3H3;/q-1;/t13-,14-,15?,16+;/m0./s1 |
| InChIKey | WLCWHXWLSPJDLV-GCLJAWKXSA-N |
| XLogP | 2.15 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|