C20H25F3O3 — CID 25011068
ethyl (2S,3S)-3-hexyl-4-methylidene-8-(trifluoromethyl)-2,3-dihydrochromene-2-carboxylate (PubChem CID 25011068) has the molecular formula C20H25F3O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl (2S,3S)-3-hexyl-4-methylidene-8-(trifluoromethyl)-2,3-dihydrochromene-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-hexyl-4-methylidene-8-(trifluoromethyl)-2,3-dihydrochromene-2-carboxylate |
|---|---|
| PubChem CID | 25011068 |
| Molecular Formula | C20H25F3O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | ethyl (2S,3S)-3-hexyl-4-methylidene-8-(trifluoromethyl)-2,3-dihydrochromene-2-carboxylate |
| SMILES | C=C1c2cccc(C(F)(F)F)c2O[C@H](C(=O)OCC)[C@H]1CCCCCC |
| InChI | InChI=1S/C20H25F3O3/c1-4-6-7-8-10-15-13(3)14-11-9-12-16(20(21,22)23)17(14)26-18(15)19(24)25-5-2/h9,11-12,15,18H,3-8,10H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | JJPSWMVHKRUVRV-YJBOKZPZSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|