C12H13ClO4 — CID 117169838
methyl 2-[2-(3-chlorophenyl)-1,3-dioxolan-4-yl]acetate (PubChem CID 117169838) has the molecular formula C12H13ClO4 and a molecular weight of 256.69 g/mol. Its IUPAC name is methyl 2-[2-(3-chlorophenyl)-1,3-dioxolan-4-yl]acetate.
| Compound Name | methyl 2-[2-(3-chlorophenyl)-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 117169838 |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | methyl 2-[2-(3-chlorophenyl)-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)CC1COC(c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C12H13ClO4/c1-15-11(14)6-10-7-16-12(17-10)8-3-2-4-9(13)5-8/h2-5,10,12H,6-7H2,1H3 |
| InChIKey | KSCHFSLBINSDGM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |