C21H25Cl2NO3 — CID 70381407
methyl 2-[4-[2-[2-(3-chlorophenyl)morpholin-4-yl]ethyl]phenyl]acetate;hydrochloride (PubChem CID 70381407) has the molecular formula C21H25Cl2NO3 and a molecular weight of 410.34 g/mol. Its IUPAC name is methyl 2-[4-[2-[2-(3-chlorophenyl)morpholin-4-yl]ethyl]phenyl]acetate;hydrochloride.
| Compound Name | methyl 2-[4-[2-[2-(3-chlorophenyl)morpholin-4-yl]ethyl]phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 70381407 |
| Molecular Formula | C21H25Cl2NO3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | methyl 2-[4-[2-[2-(3-chlorophenyl)morpholin-4-yl]ethyl]phenyl]acetate;hydrochloride |
| SMILES | COC(=O)Cc1ccc(CCN2CCOC(c3cccc(Cl)c3)C2)cc1.Cl |
| InChI | InChI=1S/C21H24ClNO3.ClH/c1-25-21(24)13-17-7-5-16(6-8-17)9-10-23-11-12-26-20(15-23)18-3-2-4-19(22)14-18;/h2-8,14,20H,9-13,15H2,1H3;1H |
| InChIKey | RNAWVDGBQLEGQG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |