C13H19NO2S — CID 124582743
(5R)-5-hexyl-3-thiophen-3-yl-1,3-oxazolidin-2-one (PubChem CID 124582743) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is (5R)-5-hexyl-3-thiophen-3-yl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-hexyl-3-thiophen-3-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 124582743 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (5R)-5-hexyl-3-thiophen-3-yl-1,3-oxazolidin-2-one |
| SMILES | CCCCCC[C@@H]1CN(c2ccsc2)C(=O)O1 |
| InChI | InChI=1S/C13H19NO2S/c1-2-3-4-5-6-12-9-14(13(15)16-12)11-7-8-17-10-11/h7-8,10,12H,2-6,9H2,1H3/t12-/m1/s1 |
| InChIKey | XTGCOZZSGWVWFF-GFCCVEGCSA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|