C17H20FNO2 — CID 89014870
3-(4-ethynyl-3-fluorophenyl)-5-hexyl-1,3-oxazolidin-2-one (PubChem CID 89014870) has the molecular formula C17H20FNO2 and a molecular weight of 289.35 g/mol. Its IUPAC name is 3-(4-ethynyl-3-fluorophenyl)-5-hexyl-1,3-oxazolidin-2-one.
| Compound Name | 3-(4-ethynyl-3-fluorophenyl)-5-hexyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89014870 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-(4-ethynyl-3-fluorophenyl)-5-hexyl-1,3-oxazolidin-2-one |
| SMILES | C#Cc1ccc(N2CC(CCCCCC)OC2=O)cc1F |
| InChI | InChI=1S/C17H20FNO2/c1-3-5-6-7-8-15-12-19(17(20)21-15)14-10-9-13(4-2)16(18)11-14/h2,9-11,15H,3,5-8,12H2,1H3 |
| InChIKey | QPRVJPOTUZDYNR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|