C18H25NO2 — CID 59580221
3-(4-cyclopropylphenyl)-5-hexyl-1,3-oxazolidin-2-one (PubChem CID 59580221) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-(4-cyclopropylphenyl)-5-hexyl-1,3-oxazolidin-2-one.
| Compound Name | 3-(4-cyclopropylphenyl)-5-hexyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59580221 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3-(4-cyclopropylphenyl)-5-hexyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC1CN(c2ccc(C3CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C18H25NO2/c1-2-3-4-5-6-17-13-19(18(20)21-17)16-11-9-15(10-12-16)14-7-8-14/h9-12,14,17H,2-8,13H2,1H3 |
| InChIKey | INFRSJGJFRJETI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|