C17H21N3O2 — CID 59580231
5-hexyl-3-quinazolin-7-yl-1,3-oxazolidin-2-one (PubChem CID 59580231) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 5-hexyl-3-quinazolin-7-yl-1,3-oxazolidin-2-one.
| Compound Name | 5-hexyl-3-quinazolin-7-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59580231 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 5-hexyl-3-quinazolin-7-yl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC1CN(c2ccc3cncnc3c2)C(=O)O1 |
| InChI | InChI=1S/C17H21N3O2/c1-2-3-4-5-6-15-11-20(17(21)22-15)14-8-7-13-10-18-12-19-16(13)9-14/h7-10,12,15H,2-6,11H2,1H3 |
| InChIKey | ISHDXPBNJSYOIA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|