C19H20N4O4 — CID 19356312
3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl-methylamino]benzoic acid (PubChem CID 19356312) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl-methylamino]benzoic acid.
| Compound Name | 3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 19356312 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-[[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl-methylamino]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(CN(C)c3cccc(C(=O)O)c3)OC2=O)cc1 |
| InChI | InChI=1S/C19H20N4O4/c1-22(15-4-2-3-13(9-15)18(24)25)10-16-11-23(19(26)27-16)14-7-5-12(6-8-14)17(20)21/h2-9,16H,10-11H2,1H3,(H3,20,21)(H,24,25) |
| InChIKey | ORVQRBGUBQEXQK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|