C24H26N4O6 — CID 173328646
benzyl 1-[3-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidine-5-carbonyl]piperidine-4-carboxylate (PubChem CID 173328646) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is benzyl 1-[3-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidine-5-carbonyl]piperidine-4-carboxylate.
| Compound Name | benzyl 1-[3-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidine-5-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 173328646 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | benzyl 1-[3-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidine-5-carbonyl]piperidine-4-carboxylate |
| SMILES | NC(=NO)c1ccc(N2CC(C(=O)N3CCC(C(=O)OCc4ccccc4)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C24H26N4O6/c25-21(26-32)17-6-8-19(9-7-17)28-14-20(34-24(28)31)22(29)27-12-10-18(11-13-27)23(30)33-15-16-4-2-1-3-5-16/h1-9,18,20,32H,10-15H2,(H2,25,26) |
| InChIKey | QKEZYJZTLVMDDW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|