C20H26N4O5 — CID 151362663
2-[1-[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidine-5-carbonyl]piperidin-4-yl]butanoic acid (PubChem CID 151362663) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[1-[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidine-5-carbonyl]piperidin-4-yl]butanoic acid.
| Compound Name | 2-[1-[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidine-5-carbonyl]piperidin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 151362663 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[1-[3-(4-carbamimidoylphenyl)-2-oxo-1,3-oxazolidine-5-carbonyl]piperidin-4-yl]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(C(=O)N3CCC(C(CC)C(=O)O)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C20H26N4O5/c1-2-15(19(26)27)12-7-9-23(10-8-12)18(25)16-11-24(20(28)29-16)14-5-3-13(4-6-14)17(21)22/h3-6,12,15-16H,2,7-11H2,1H3,(H3,21,22)(H,26,27) |
| InChIKey | OOUCFDZEFCSLOX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|