C13H17N3O3 — CID 87106404
[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl 1-methylazetidine-3-carboxylate (PubChem CID 87106404) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is [4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl 1-methylazetidine-3-carboxylate.
| Compound Name | [4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl 1-methylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 87106404 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methyl 1-methylazetidine-3-carboxylate |
| SMILES | CN1CC(C(=O)OCc2ccc(/C(N)=N/O)cc2)C1 |
| InChI | InChI=1S/C13H17N3O3/c1-16-6-11(7-16)13(17)19-8-9-2-4-10(5-3-9)12(14)15-18/h2-5,11,18H,6-8H2,1H3,(H2,14,15) |
| InChIKey | GIWXKOFJJPEVES-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|