C16H18N4O7S — CID 139683435
(4-nitrophenyl)methyl (2E)-4-acetylsulfanyl-2-(2-amino-2-oxoethoxy)iminopyrrolidine-1-carboxylate (PubChem CID 139683435) has the molecular formula C16H18N4O7S and a molecular weight of 410.41 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2E)-4-acetylsulfanyl-2-(2-amino-2-oxoethoxy)iminopyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2E)-4-acetylsulfanyl-2-(2-amino-2-oxoethoxy)iminopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139683435 |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (4-nitrophenyl)methyl (2E)-4-acetylsulfanyl-2-(2-amino-2-oxoethoxy)iminopyrrolidine-1-carboxylate |
| SMILES | CC(=O)SC1C/C(=N\OCC(N)=O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C16H18N4O7S/c1-10(21)28-13-6-15(18-27-9-14(17)22)19(7-13)16(23)26-8-11-2-4-12(5-3-11)20(24)25/h2-5,13H,6-9H2,1H3,(H2,17,22)/b18-15+ |
| InChIKey | PASUNPWIOKPGSM-OBGWFSINSA-N |
| XLogP | 1.40 |
| TPSA | 154.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|