C17H22N4O7S2 — CID 57087816
(4-nitrophenyl)methyl (4S)-4-acetylsulfanyl-2-[(2-methyl-2-methylsulfonylhydrazinyl)methylidene]pyrrolidine-1-carboxylate (PubChem CID 57087816) has the molecular formula C17H22N4O7S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4S)-4-acetylsulfanyl-2-[(2-methyl-2-methylsulfonylhydrazinyl)methylidene]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4S)-4-acetylsulfanyl-2-[(2-methyl-2-methylsulfonylhydrazinyl)methylidene]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57087816 |
| Molecular Formula | C17H22N4O7S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (4-nitrophenyl)methyl (4S)-4-acetylsulfanyl-2-[(2-methyl-2-methylsulfonylhydrazinyl)methylidene]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@H]1CC(=CNN(C)S(C)(=O)=O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H22N4O7S2/c1-12(22)29-16-8-15(9-18-19(2)30(3,26)27)20(10-16)17(23)28-11-13-4-6-14(7-5-13)21(24)25/h4-7,9,16,18H,8,10-11H2,1-3H3/t16-/m0/s1 |
| InChIKey | IYALQKBPNMPWEC-INIZCTEOSA-N |
| XLogP | 1.82 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|