C21H23NO5S — CID 150335981
dibenzyl 2-methoxy-4-sulfanylpyrrolidine-1,2-dicarboxylate (PubChem CID 150335981) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is dibenzyl 2-methoxy-4-sulfanylpyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl 2-methoxy-4-sulfanylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 150335981 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | dibenzyl 2-methoxy-4-sulfanylpyrrolidine-1,2-dicarboxylate |
| SMILES | COC1(C(=O)OCc2ccccc2)CC(S)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO5S/c1-25-21(19(23)26-14-16-8-4-2-5-9-16)12-18(28)13-22(21)20(24)27-15-17-10-6-3-7-11-17/h2-11,18,28H,12-15H2,1H3 |
| InChIKey | GQRKLFYZRGDUAJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|