C26H27NO4S2 — CID 70003324
methyl 1-methylsulfonyl-4-tritylsulfanylpyrrolidine-2-carboxylate (PubChem CID 70003324) has the molecular formula C26H27NO4S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is methyl 1-methylsulfonyl-4-tritylsulfanylpyrrolidine-2-carboxylate.
| Compound Name | methyl 1-methylsulfonyl-4-tritylsulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70003324 |
| Molecular Formula | C26H27NO4S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | methyl 1-methylsulfonyl-4-tritylsulfanylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1S(C)(=O)=O |
| InChI | InChI=1S/C26H27NO4S2/c1-31-25(28)24-18-23(19-27(24)33(2,29)30)32-26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,23-24H,18-19H2,1-2H3 |
| InChIKey | GRDIGURUBHFLGC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|