C41H42N2O5S2 — CID 70001493
tert-butyl 3-[[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidine-2-carbonyl]amino]propanoate (PubChem CID 70001493) has the molecular formula C41H42N2O5S2 and a molecular weight of 706.93 g/mol. Its IUPAC name is tert-butyl 3-[[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidine-2-carbonyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 70001493 |
| Molecular Formula | C41H42N2O5S2 |
| Molecular Weight | 706.93 g/mol |
| Exact Mass | 706.25 |
| IUPAC Name | tert-butyl 3-[[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-tritylsulfanylpyrrolidine-2-carbonyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNC(=O)[C@@H]1C[C@@H](SC(c2ccccc2)(c2ccccc2)c2ccccc2)CN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C41H42N2O5S2/c1-40(2,3)48-38(44)25-26-42-39(45)37-28-35(29-43(37)50(46,47)36-24-23-30-15-13-14-16-31(30)27-36)49-41(32-17-7-4-8-18-32,33-19-9-5-10-20-33)34-21-11-6-12-22-34/h4-24,27,35,37H,25-26,28-29H2,1-3H3,(H,42,45)/t35-,37+/m1/s1 |
| InChIKey | YQVLIJNLHXWLSL-BZFILIQBSA-N |
| XLogP | 7.54 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.93 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|