C17H18N2O4S2 — CID 141072281
S-(5-carbamoyl-1-naphthalen-2-ylsulfonylpyrrolidin-3-yl) ethanethioate (PubChem CID 141072281) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is S-(5-carbamoyl-1-naphthalen-2-ylsulfonylpyrrolidin-3-yl) ethanethioate.
| Compound Name | S-(5-carbamoyl-1-naphthalen-2-ylsulfonylpyrrolidin-3-yl) ethanethioate |
|---|---|
| PubChem CID | 141072281 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | S-(5-carbamoyl-1-naphthalen-2-ylsulfonylpyrrolidin-3-yl) ethanethioate |
| SMILES | CC(=O)SC1CC(C(N)=O)N(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C17H18N2O4S2/c1-11(20)24-14-9-16(17(18)21)19(10-14)25(22,23)15-7-6-12-4-2-3-5-13(12)8-15/h2-8,14,16H,9-10H2,1H3,(H2,18,21) |
| InChIKey | NXXYREKDQDVVLP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|