C37H37NO4S2 — CID 141046954
methyl 1-naphthalen-2-ylsulfonyl-4-(tribenzyl-λ4-sulfanyl)pyrrolidine-2-carboxylate (PubChem CID 141046954) has the molecular formula C37H37NO4S2 and a molecular weight of 623.84 g/mol. Its IUPAC name is methyl 1-naphthalen-2-ylsulfonyl-4-(tribenzyl-λ4-sulfanyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-naphthalen-2-ylsulfonyl-4-(tribenzyl-λ4-sulfanyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141046954 |
| Molecular Formula | C37H37NO4S2 |
| Molecular Weight | 623.84 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | methyl 1-naphthalen-2-ylsulfonyl-4-(tribenzyl-λ4-sulfanyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(S(Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)CN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H37NO4S2/c1-42-37(39)36-24-35(25-38(36)44(40,41)34-22-21-32-19-11-12-20-33(32)23-34)43(26-29-13-5-2-6-14-29,27-30-15-7-3-8-16-30)28-31-17-9-4-10-18-31/h2-23,35-36H,24-28H2,1H3 |
| InChIKey | BHRSJTAMDLIBQJ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.84 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |