C22H23NO4S — CID 57063024
[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-phenylmethoxypyrrolidin-2-yl]methanol (PubChem CID 57063024) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-phenylmethoxypyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-phenylmethoxypyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 57063024 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [(2S,4R)-1-naphthalen-2-ylsulfonyl-4-phenylmethoxypyrrolidin-2-yl]methanol |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1C[C@H](OCc2ccccc2)C[C@H]1CO |
| InChI | InChI=1S/C22H23NO4S/c24-15-20-13-21(27-16-17-6-2-1-3-7-17)14-23(20)28(25,26)22-11-10-18-8-4-5-9-19(18)12-22/h1-12,20-21,24H,13-16H2/t20-,21+/m0/s1 |
| InChIKey | HKJMOZGLWUHMQD-LEWJYISDSA-N |
| XLogP | 3.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |