C24H27NO3S2 — CID 87831337
(3S,5S)-1-naphthalen-2-ylsulfonyl-5-(3-phenylpropoxymethyl)pyrrolidine-3-thiol (PubChem CID 87831337) has the molecular formula C24H27NO3S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is (3S,5S)-1-naphthalen-2-ylsulfonyl-5-(3-phenylpropoxymethyl)pyrrolidine-3-thiol.
| Compound Name | (3S,5S)-1-naphthalen-2-ylsulfonyl-5-(3-phenylpropoxymethyl)pyrrolidine-3-thiol |
|---|---|
| PubChem CID | 87831337 |
| Molecular Formula | C24H27NO3S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | (3S,5S)-1-naphthalen-2-ylsulfonyl-5-(3-phenylpropoxymethyl)pyrrolidine-3-thiol |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1C[C@@H](S)C[C@H]1COCCCc1ccccc1 |
| InChI | InChI=1S/C24H27NO3S2/c26-30(27,24-13-12-20-10-4-5-11-21(20)15-24)25-17-23(29)16-22(25)18-28-14-6-9-19-7-2-1-3-8-19/h1-5,7-8,10-13,15,22-23,29H,6,9,14,16-18H2/t22-,23-/m0/s1 |
| InChIKey | UOWARJUTHDQWBE-GOTSBHOMSA-N |
| XLogP | 4.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|