C21H23N3O2S2 — CID 22671688
1-naphthalen-2-ylsulfonyl-5-[(pyridin-3-ylmethylamino)methyl]pyrrolidine-3-thiol (PubChem CID 22671688) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-naphthalen-2-ylsulfonyl-5-[(pyridin-3-ylmethylamino)methyl]pyrrolidine-3-thiol.
| Compound Name | 1-naphthalen-2-ylsulfonyl-5-[(pyridin-3-ylmethylamino)methyl]pyrrolidine-3-thiol |
|---|---|
| PubChem CID | 22671688 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-naphthalen-2-ylsulfonyl-5-[(pyridin-3-ylmethylamino)methyl]pyrrolidine-3-thiol |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CC(S)CC1CNCc1cccnc1 |
| InChI | InChI=1S/C21H23N3O2S2/c25-28(26,21-8-7-17-5-1-2-6-18(17)10-21)24-15-20(27)11-19(24)14-23-13-16-4-3-9-22-12-16/h1-10,12,19-20,23,27H,11,13-15H2 |
| InChIKey | VPNICSTYRDFPOL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|