C20H24N2O4S2 — CID 18618378
(4-hydroxypiperidin-1-yl)-(1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl)methanone (PubChem CID 18618378) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is (4-hydroxypiperidin-1-yl)-(1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl)methanone.
| Compound Name | (4-hydroxypiperidin-1-yl)-(1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl)methanone |
|---|---|
| PubChem CID | 18618378 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (4-hydroxypiperidin-1-yl)-(1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl)methanone |
| SMILES | O=C(C1CC(S)CN1S(=O)(=O)c1ccc2ccccc2c1)N1CCC(O)CC1 |
| InChI | InChI=1S/C20H24N2O4S2/c23-16-7-9-21(10-8-16)20(24)19-12-17(27)13-22(19)28(25,26)18-6-5-14-3-1-2-4-15(14)11-18/h1-6,11,16-17,19,23,27H,7-10,12-13H2 |
| InChIKey | BVHZYIUNVDFFIQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|