C21H22N2O2S2 — CID 22671912
5-(anilinomethyl)-1-naphthalen-2-ylsulfonylpyrrolidine-3-thiol (PubChem CID 22671912) has the molecular formula C21H22N2O2S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 5-(anilinomethyl)-1-naphthalen-2-ylsulfonylpyrrolidine-3-thiol.
| Compound Name | 5-(anilinomethyl)-1-naphthalen-2-ylsulfonylpyrrolidine-3-thiol |
|---|---|
| PubChem CID | 22671912 |
| Molecular Formula | C21H22N2O2S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 5-(anilinomethyl)-1-naphthalen-2-ylsulfonylpyrrolidine-3-thiol |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CC(S)CC1CNc1ccccc1 |
| InChI | InChI=1S/C21H22N2O2S2/c24-27(25,21-11-10-16-6-4-5-7-17(16)12-21)23-15-20(26)13-19(23)14-22-18-8-2-1-3-9-18/h1-12,19-20,22,26H,13-15H2 |
| InChIKey | CRNZCTJMXABIOO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|