C22H22N4O4S2 — CID 87884537
1-[[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbonyl]amino]-3-phenylurea (PubChem CID 87884537) has the molecular formula C22H22N4O4S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbonyl]amino]-3-phenylurea.
| Compound Name | 1-[[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbonyl]amino]-3-phenylurea |
|---|---|
| PubChem CID | 87884537 |
| Molecular Formula | C22H22N4O4S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 1-[[(2S,4R)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbonyl]amino]-3-phenylurea |
| SMILES | O=C(NNC(=O)[C@@H]1C[C@@H](S)CN1S(=O)(=O)c1ccc2ccccc2c1)Nc1ccccc1 |
| InChI | InChI=1S/C22H22N4O4S2/c27-21(24-25-22(28)23-17-8-2-1-3-9-17)20-13-18(31)14-26(20)32(29,30)19-11-10-15-6-4-5-7-16(15)12-19/h1-12,18,20,31H,13-14H2,(H,24,27)(H2,23,25,28)/t18-,20+/m1/s1 |
| InChIKey | HZHBEYXBQGJDPG-QUCCMNQESA-N |
| XLogP | 2.75 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|