C21H26N2O5S2 — CID 86585058
methyl (2S)-3-methyl-2-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbonyl]amino]butanoate (PubChem CID 86585058) has the molecular formula C21H26N2O5S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbonyl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 86585058 |
| Molecular Formula | C21H26N2O5S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@@H]1C[C@H](S)CN1S(=O)(=O)c1ccc2ccccc2c1)C(C)C |
| InChI | InChI=1S/C21H26N2O5S2/c1-13(2)19(21(25)28-3)22-20(24)18-11-16(29)12-23(18)30(26,27)17-9-8-14-6-4-5-7-15(14)10-17/h4-10,13,16,18-19,29H,11-12H2,1-3H3,(H,22,24)/t16-,18-,19-/m0/s1 |
| InChIKey | CXLSTXLTSNOWAP-WDSOQIARSA-N |
| XLogP | 2.21 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|