C17H18F3N3O5S2 — CID 87884483
(2S,4R)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide;2,2,2-trifluoroacetic acid (PubChem CID 87884483) has the molecular formula C17H18F3N3O5S2 and a molecular weight of 465.48 g/mol. Its IUPAC name is (2S,4R)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,4R)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87884483 |
| Molecular Formula | C17H18F3N3O5S2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | (2S,4R)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide;2,2,2-trifluoroacetic acid |
| SMILES | NNC(=O)[C@@H]1C[C@@H](S)CN1S(=O)(=O)c1ccc2ccccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H17N3O3S2.C2HF3O2/c16-17-15(19)14-8-12(22)9-18(14)23(20,21)13-6-5-10-3-1-2-4-11(10)7-13;3-2(4,5)1(6)7/h1-7,12,14,22H,8-9,16H2,(H,17,19);(H,6,7)/t12-,14+;/m1./s1 |
| InChIKey | AEYDBRRBLKMXNL-OJMBIDBESA-N |
| XLogP | 1.52 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|