About 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid
3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid (PubChem CID 87833216) has the molecular formula C23H23NO5S2
and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid |
| PubChem CID | 87833216 |
| Molecular Formula | C23H23NO5S2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COC[C@@H]2C[C@H](S)CN2S(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C23H23NO5S2/c25-23(26)19-7-3-4-16(10-19)14-29-15-20-12-21(30)13-24(20)31(27,28)22-9-8-17-5-1-2-6-18(17)11-22/h1-11,20-21,30H,12-15H2,(H,25,26)/t20-,21-/m0/s1 |
| InChIKey | FUUAYGBFYLSKAQ-SFTDATJTSA-N |
| XLogP | 3.82 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid?
The IUPAC name of 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid (CID 87833216) is 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid.
What is the SMILES notation for 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid?
The canonical SMILES for 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid is O=C(O)c1cccc(COC[C@@H]2C[C@H](S)CN2S(=O)(=O)c2ccc3ccccc3c2)c1.
What is the InChIKey of 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid?
The InChIKey is FUUAYGBFYLSKAQ-SFTDATJTSA-N. The full InChI is InChI=1S/C23H23NO5S2/c25-23(26)19-7-3-4-16(10-19)14-29-15-20-12-21(30)13-24(20)31(27,28)22-9-8-17-5-1-2-6-18(17)11-22/h1-11,20-21,30H,12-15H2,(H,25,26)/t20-,21-/m0/s1.
What are the key properties of 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid?
3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid has a molecular weight of 457.57 g/mol, XLogP of 3.82, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S,4S)-1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl]methoxymethyl]benzoic acid is sourced from PubChem (CID 87833216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).