C23H23NO5S2 — CID 87833219
3-[(1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl)methoxymethyl]benzoic acid (PubChem CID 87833219) has the molecular formula C23H23NO5S2 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-[(1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl)methoxymethyl]benzoic acid.
| Compound Name | 3-[(1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl)methoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 87833219 |
| Molecular Formula | C23H23NO5S2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 3-[(1-naphthalen-2-ylsulfonyl-4-sulfanylpyrrolidin-2-yl)methoxymethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COCC2CC(S)CN2S(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C23H23NO5S2/c25-23(26)19-7-3-4-16(10-19)14-29-15-20-12-21(30)13-24(20)31(27,28)22-9-8-17-5-1-2-6-18(17)11-22/h1-11,20-21,30H,12-15H2,(H,25,26) |
| InChIKey | FUUAYGBFYLSKAQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|