C22H23N3O5S3 — CID 87884613
(2S,4R)-N'-(4-methylphenyl)sulfonyl-1-naphthalen-1-ylsulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide (PubChem CID 87884613) has the molecular formula C22H23N3O5S3 and a molecular weight of 505.64 g/mol. Its IUPAC name is (2S,4R)-N'-(4-methylphenyl)sulfonyl-1-naphthalen-1-ylsulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide.
| Compound Name | (2S,4R)-N'-(4-methylphenyl)sulfonyl-1-naphthalen-1-ylsulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 87884613 |
| Molecular Formula | C22H23N3O5S3 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | (2S,4R)-N'-(4-methylphenyl)sulfonyl-1-naphthalen-1-ylsulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)[C@@H]2C[C@@H](S)CN2S(=O)(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H23N3O5S3/c1-15-9-11-18(12-10-15)32(27,28)24-23-22(26)20-13-17(31)14-25(20)33(29,30)21-8-4-6-16-5-2-3-7-19(16)21/h2-12,17,20,24,31H,13-14H2,1H3,(H,23,26)/t17-,20+/m1/s1 |
| InChIKey | IYPWPZFVINSWEK-XLIONFOSSA-N |
| XLogP | 2.22 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|