C19H22FN3O5S3 — CID 87884495
(2S,4R)-1-(3-fluorophenyl)sulfonyl-N'-methyl-N'-(4-methylphenyl)sulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide (PubChem CID 87884495) has the molecular formula C19H22FN3O5S3 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2S,4R)-1-(3-fluorophenyl)sulfonyl-N'-methyl-N'-(4-methylphenyl)sulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide.
| Compound Name | (2S,4R)-1-(3-fluorophenyl)sulfonyl-N'-methyl-N'-(4-methylphenyl)sulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 87884495 |
| Molecular Formula | C19H22FN3O5S3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | (2S,4R)-1-(3-fluorophenyl)sulfonyl-N'-methyl-N'-(4-methylphenyl)sulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)NC(=O)[C@@H]2C[C@@H](S)CN2S(=O)(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H22FN3O5S3/c1-13-6-8-16(9-7-13)30(25,26)22(2)21-19(24)18-11-15(29)12-23(18)31(27,28)17-5-3-4-14(20)10-17/h3-10,15,18,29H,11-12H2,1-2H3,(H,21,24)/t15-,18+/m1/s1 |
| InChIKey | RGNCVHSEARUOTR-QAPCUYQASA-N |
| XLogP | 1.55 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|