C21H27N3O5S3 — CID 87884560
(2S,4R)-N'-(4-methylphenyl)sulfonyl-1-(4-propylphenyl)sulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide (PubChem CID 87884560) has the molecular formula C21H27N3O5S3 and a molecular weight of 497.66 g/mol. Its IUPAC name is (2S,4R)-N'-(4-methylphenyl)sulfonyl-1-(4-propylphenyl)sulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide.
| Compound Name | (2S,4R)-N'-(4-methylphenyl)sulfonyl-1-(4-propylphenyl)sulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 87884560 |
| Molecular Formula | C21H27N3O5S3 |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (2S,4R)-N'-(4-methylphenyl)sulfonyl-1-(4-propylphenyl)sulfonyl-4-sulfanylpyrrolidine-2-carbohydrazide |
| SMILES | CCCc1ccc(S(=O)(=O)N2C[C@H](S)C[C@H]2C(=O)NNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H27N3O5S3/c1-3-4-16-7-11-19(12-8-16)32(28,29)24-14-17(30)13-20(24)21(25)22-23-31(26,27)18-9-5-15(2)6-10-18/h5-12,17,20,23,30H,3-4,13-14H2,1-2H3,(H,22,25)/t17-,20+/m1/s1 |
| InChIKey | FFBCNNOIAQLDHR-XLIONFOSSA-N |
| XLogP | 2.02 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|