C20H34N4O5S3 — CID 87884523
(2S,4R)-N-butyl-2-[[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]carbamoyl]-4-sulfanylpyrrolidine-1-sulfonamide (PubChem CID 87884523) has the molecular formula C20H34N4O5S3 and a molecular weight of 506.72 g/mol. Its IUPAC name is (2S,4R)-N-butyl-2-[[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]carbamoyl]-4-sulfanylpyrrolidine-1-sulfonamide.
| Compound Name | (2S,4R)-N-butyl-2-[[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]carbamoyl]-4-sulfanylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 87884523 |
| Molecular Formula | C20H34N4O5S3 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | (2S,4R)-N-butyl-2-[[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]carbamoyl]-4-sulfanylpyrrolidine-1-sulfonamide |
| SMILES | CCCCNS(=O)(=O)N1C[C@H](S)C[C@H]1C(=O)NN(CC(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H34N4O5S3/c1-5-6-11-21-32(28,29)23-14-17(30)12-19(23)20(25)22-24(13-15(2)3)31(26,27)18-9-7-16(4)8-10-18/h7-10,15,17,19,21,30H,5-6,11-14H2,1-4H3,(H,22,25)/t17-,19+/m1/s1 |
| InChIKey | KDTQIQLULMLFJZ-MJGOQNOKSA-N |
| XLogP | 1.68 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|