C17H28N2O3S — CID 141017329
N'-[(2S)-2-methylbutyl]-N'-(4-methylphenyl)sulfonylpentanehydrazide (PubChem CID 141017329) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N'-[(2S)-2-methylbutyl]-N'-(4-methylphenyl)sulfonylpentanehydrazide.
| Compound Name | N'-[(2S)-2-methylbutyl]-N'-(4-methylphenyl)sulfonylpentanehydrazide |
|---|---|
| PubChem CID | 141017329 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N'-[(2S)-2-methylbutyl]-N'-(4-methylphenyl)sulfonylpentanehydrazide |
| SMILES | CCCCC(=O)NN(C[C@@H](C)CC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H28N2O3S/c1-5-7-8-17(20)18-19(13-14(3)6-2)23(21,22)16-11-9-15(4)10-12-16/h9-12,14H,5-8,13H2,1-4H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | XLSMIXYFNFKPRD-AWEZNQCLSA-N |
| XLogP | 3.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|